C22H14F3N3O4S2 — CID 59007996
2-[2-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 59007996) has the molecular formula C22H14F3N3O4S2 and a molecular weight of 505.50 g/mol. Its IUPAC name is 2-[2-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 2-[2-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 59007996 |
| Molecular Formula | C22H14F3N3O4S2 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 2-[2-[2-[4-(trifluoromethylsulfonyl)phenyl]ethynyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc2nc(C#Cc3ccc(S(=O)(=O)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C22H14F3N3O4S2/c23-22(24,25)33(29,30)16-9-5-14(6-10-16)7-12-21-27-18-11-8-15(13-19(18)28-21)17-3-1-2-4-20(17)34(26,31)32/h1-6,8-11,13H,(H,27,28)(H2,26,31,32) |
| InChIKey | YMACGESPXWBGER-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|