C21H16F3N3O2S2 — CID 24962365
2-[2-[sulfanyl-[4-(trifluoromethyl)phenyl]methyl]-3H-benzimidazol-5-yl]benzenesulfonamide (PubChem CID 24962365) has the molecular formula C21H16F3N3O2S2 and a molecular weight of 463.51 g/mol. Its IUPAC name is 2-[2-[sulfanyl-[4-(trifluoromethyl)phenyl]methyl]-3H-benzimidazol-5-yl]benzenesulfonamide.
| Compound Name | 2-[2-[sulfanyl-[4-(trifluoromethyl)phenyl]methyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 24962365 |
| Molecular Formula | C21H16F3N3O2S2 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 2-[2-[sulfanyl-[4-(trifluoromethyl)phenyl]methyl]-3H-benzimidazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1-c1ccc2nc(C(S)c3ccc(C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H16F3N3O2S2/c22-21(23,24)14-8-5-12(6-9-14)19(30)20-26-16-10-7-13(11-17(16)27-20)15-3-1-2-4-18(15)31(25,28)29/h1-11,19,30H,(H,26,27)(H2,25,28,29) |
| InChIKey | YSEOSIUPGAPXSD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|