C13H12Br2N2O3S — CID 59014248
6,6-dibromo-2-(cyclopropanecarbonylamino)-7-oxo-4,5-dihydro-1-benzothiophene-3-carboxamide (PubChem CID 59014248) has the molecular formula C13H12Br2N2O3S and a molecular weight of 436.13 g/mol. Its IUPAC name is 6,6-dibromo-2-(cyclopropanecarbonylamino)-7-oxo-4,5-dihydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6,6-dibromo-2-(cyclopropanecarbonylamino)-7-oxo-4,5-dihydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 59014248 |
| Molecular Formula | C13H12Br2N2O3S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | 6,6-dibromo-2-(cyclopropanecarbonylamino)-7-oxo-4,5-dihydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)C2CC2)sc2c1CCC(Br)(Br)C2=O |
| InChI | InChI=1S/C13H12Br2N2O3S/c14-13(15)4-3-6-7(10(16)19)12(21-8(6)9(13)18)17-11(20)5-1-2-5/h5H,1-4H2,(H2,16,19)(H,17,20) |
| InChIKey | QVMSJWOXVOEKLA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|