C16H25N3O6 — CID 59016879
N-[2-[bis[2-(prop-2-enoylamino)ethoxy]methoxy]ethyl]prop-2-enamide (PubChem CID 59016879) has the molecular formula C16H25N3O6 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-[bis[2-(prop-2-enoylamino)ethoxy]methoxy]ethyl]prop-2-enamide.
| Compound Name | N-[2-[bis[2-(prop-2-enoylamino)ethoxy]methoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 59016879 |
| Molecular Formula | C16H25N3O6 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | N-[2-[bis[2-(prop-2-enoylamino)ethoxy]methoxy]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCOC(OCCNC(=O)C=C)OCCNC(=O)C=C |
| InChI | InChI=1S/C16H25N3O6/c1-4-13(20)17-7-10-23-16(24-11-8-18-14(21)5-2)25-12-9-19-15(22)6-3/h4-6,16H,1-3,7-12H2,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | KTSGHVJGDNTWNG-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|