C24H24NOP — CID 59017656
diphenyl-[2-[(4R)-4-propyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane (PubChem CID 59017656) has the molecular formula C24H24NOP and a molecular weight of 373.44 g/mol. Its IUPAC name is diphenyl-[2-[(4R)-4-propyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane.
| Compound Name | diphenyl-[2-[(4R)-4-propyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 59017656 |
| Molecular Formula | C24H24NOP |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | diphenyl-[2-[(4R)-4-propyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane |
| SMILES | CCC[C@@H]1COC(c2ccccc2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H24NOP/c1-2-11-19-18-26-24(25-19)22-16-9-10-17-23(22)27(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-10,12-17,19H,2,11,18H2,1H3/t19-/m1/s1 |
| InChIKey | ZLWXKFJGYPTPOD-LJQANCHMSA-N |
| XLogP | 4.39 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|