C17H15ClN4O4 — CID 59018346
2-(2-chlorophenoxy)-N-[2-(4-nitro-1H-benzimidazol-2-yl)ethyl]acetamide (PubChem CID 59018346) has the molecular formula C17H15ClN4O4 and a molecular weight of 374.78 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[2-(4-nitro-1H-benzimidazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[2-(4-nitro-1H-benzimidazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 59018346 |
| Molecular Formula | C17H15ClN4O4 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[2-(4-nitro-1H-benzimidazol-2-yl)ethyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)NCCc1nc2c([N+](=O)[O-])cccc2[nH]1 |
| InChI | InChI=1S/C17H15ClN4O4/c18-11-4-1-2-7-14(11)26-10-16(23)19-9-8-15-20-12-5-3-6-13(22(24)25)17(12)21-15/h1-7H,8-10H2,(H,19,23)(H,20,21) |
| InChIKey | RCNPZXSOEURKCZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|