C10H15N3O3S — CID 59020464
N'-(4-amino-2-methoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 59020464) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is N'-(4-amino-2-methoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4-amino-2-methoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 59020464 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N'-(4-amino-2-methoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | COc1cc(N)ccc1S(=O)(=O)/N=C/N(C)C |
| InChI | InChI=1S/C10H15N3O3S/c1-13(2)7-12-17(14,15)10-5-4-8(11)6-9(10)16-3/h4-7H,11H2,1-3H3/b12-7+ |
| InChIKey | IWFABZFCYBCOEE-KPKJPENVSA-N |
| XLogP | 0.56 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|