C29H28N8O3S — CID 59020539
N-[5-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]-2-pyridinyl]benzamide (PubChem CID 59020539) has the molecular formula C29H28N8O3S and a molecular weight of 568.66 g/mol. Its IUPAC name is N-[5-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]-2-pyridinyl]benzamide.
| Compound Name | N-[5-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 59020539 |
| Molecular Formula | C29H28N8O3S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | N-[5-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]-2-pyridinyl]benzamide |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5ccc(NC(=O)c6ccccc6)nc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C29H28N8O3S/c1-39-22-14-20-21(15-23(22)40-2)34-26-25(20)27(32-17-31-26)36-10-12-37(13-11-36)29(41)33-19-8-9-24(30-16-19)35-28(38)18-6-4-3-5-7-18/h3-9,14-17H,10-13H2,1-2H3,(H,33,41)(H,30,35,38)(H,31,32,34) |
| InChIKey | PJOKQJAUNHVLBR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|