C24H27FN2O7 — CID 59021406
2-[2-[4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]-3-fluorophenoxy]ethoxy]acetic acid (PubChem CID 59021406) has the molecular formula C24H27FN2O7 and a molecular weight of 474.49 g/mol. Its IUPAC name is 2-[2-[4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]-3-fluorophenoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]-3-fluorophenoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 59021406 |
| Molecular Formula | C24H27FN2O7 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[2-[4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]-3-fluorophenoxy]ethoxy]acetic acid |
| SMILES | CCOc1cc(C2=NN(C(=O)c3ccc(OCCOCC(=O)O)cc3F)CCC2)ccc1OC |
| InChI | InChI=1S/C24H27FN2O7/c1-3-33-22-13-16(6-9-21(22)31-2)20-5-4-10-27(26-20)24(30)18-8-7-17(14-19(18)25)34-12-11-32-15-23(28)29/h6-9,13-14H,3-5,10-12,15H2,1-2H3,(H,28,29) |
| InChIKey | ISFUAZFPCYIDDC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|