C23H21ClN6O3 — CID 91568291
2-[[3-chloro-4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]phenyl]diazenyl]propanedinitrile (PubChem CID 91568291) has the molecular formula C23H21ClN6O3 and a molecular weight of 464.91 g/mol. Its IUPAC name is 2-[[3-chloro-4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]phenyl]diazenyl]propanedinitrile.
| Compound Name | 2-[[3-chloro-4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]phenyl]diazenyl]propanedinitrile |
|---|---|
| PubChem CID | 91568291 |
| Molecular Formula | C23H21ClN6O3 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[[3-chloro-4-[6-(3-ethoxy-4-methoxyphenyl)-4,5-dihydro-3H-pyridazine-2-carbonyl]phenyl]diazenyl]propanedinitrile |
| SMILES | CCOc1cc(C2=NN(C(=O)c3ccc(/N=N/C(C#N)C#N)cc3Cl)CCC2)ccc1OC |
| InChI | InChI=1S/C23H21ClN6O3/c1-3-33-22-11-15(6-9-21(22)32-2)20-5-4-10-30(29-20)23(31)18-8-7-16(12-19(18)24)27-28-17(13-25)14-26/h6-9,11-12,17H,3-5,10H2,1-2H3/b28-27+ |
| InChIKey | BHTICMSZQRWGLL-BYYHNAKLSA-N |
| XLogP | 4.89 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|