C21H10F8N4Pt — CID 59022114
3,5-bis(trifluoromethyl)pyrazol-1-ide;2-(2,4-difluoro-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine;platinum(2+) (PubChem CID 59022114) has the molecular formula C21H10F8N4Pt and a molecular weight of 665.40 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)pyrazol-1-ide;2-(2,4-difluoro-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine;platinum(2+).
| Compound Name | 3,5-bis(trifluoromethyl)pyrazol-1-ide;2-(2,4-difluoro-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine;platinum(2+) |
|---|---|
| PubChem CID | 59022114 |
| Molecular Formula | C21H10F8N4Pt |
| Molecular Weight | 665.40 g/mol |
| Exact Mass | 665.04 |
| IUPAC Name | 3,5-bis(trifluoromethyl)pyrazol-1-ide;2-(2,4-difluoro-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine;platinum(2+) |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)[n-]n1.Fc1cc(F)c(-c2ccccn2)[c-]c1-c1ccccn1.[Pt+2] |
| InChI | InChI=1S/C16H9F2N2.C5HF6N2.Pt/c17-13-10-14(18)12(16-6-2-4-8-20-16)9-11(13)15-5-1-3-7-19-15;6-4(7,8)2-1-3(13-12-2)5(9,10)11;/h1-8,10H;1H;/q2*-1;+2 |
| InChIKey | LFDZWWMYFDIZFV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 52.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|