C17H9F12N5 — CID 122630463
2,6-bis[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyridine (PubChem CID 122630463) has the molecular formula C17H9F12N5 and a molecular weight of 511.27 g/mol. Its IUPAC name is 2,6-bis[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyridine.
| Compound Name | 2,6-bis[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 122630463 |
| Molecular Formula | C17H9F12N5 |
| Molecular Weight | 511.27 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 2,6-bis[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyridine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)n(Cc2cccc(Cn3nc(C(F)(F)F)cc3C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C17H9F12N5/c18-14(19,20)10-4-12(16(24,25)26)33(31-10)6-8-2-1-3-9(30-8)7-34-13(17(27,28)29)5-11(32-34)15(21,22)23/h1-5H,6-7H2 |
| InChIKey | OIAFQTRUFYZUGA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |