C30H40O15 — CID 59022374
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S,5R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 59022374) has the molecular formula C30H40O15 and a molecular weight of 640.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S,5R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S,5R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59022374 |
| Molecular Formula | C30H40O15 |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(4S,5R,6S)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC[C@@H]2OC(c3ccccc3)O[C@H]([C@H]3COC(C)(C)O3)[C@@H]2O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H40O15/c1-15(31)36-13-21-25(39-16(2)32)26(40-17(3)33)27(41-18(4)34)29(43-21)37-12-20-23(35)24(22-14-38-30(5,6)45-22)44-28(42-20)19-10-8-7-9-11-19/h7-11,20-29,35H,12-14H2,1-6H3/t20-,21+,22+,23+,24+,25+,26-,27+,28?,29+/m0/s1 |
| InChIKey | CLVMOBPOQUCQJU-RQNLVCFISA-N |
| XLogP | 1.08 |
| TPSA | 180.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|