C23H34O13 — CID 91691864
[(2R,3S,4S,5R)-3,4-diacetyloxy-5-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]oxolan-2-yl]methyl acetate (PubChem CID 91691864) has the molecular formula C23H34O13 and a molecular weight of 518.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-diacetyloxy-5-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4-diacetyloxy-5-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91691864 |
| Molecular Formula | C23H34O13 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-diacetyloxy-5-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC2C(C3COC(C)(C)O3)OC3OC(C)(C)OC32)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H34O13/c1-10(24)27-8-13-15(29-11(2)25)18(30-12(3)26)20(31-13)33-17-16(14-9-28-22(4,5)34-14)32-21-19(17)35-23(6,7)36-21/h13-21H,8-9H2,1-7H3/t13-,14?,15+,16?,17?,18+,19?,20-,21?/m1/s1 |
| InChIKey | MQCFJXPPEQIJPD-JRCUSTFLSA-N |
| XLogP | 0.55 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|