C24H34FN3O7 — CID 59022475
diethyl (Z)-2-[(Z)-[amino-[1-[(5-fluoro-2-methylphenyl)methyl]-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate (PubChem CID 59022475) has the molecular formula C24H34FN3O7 and a molecular weight of 495.55 g/mol. Its IUPAC name is diethyl (Z)-2-[(Z)-[amino-[1-[(5-fluoro-2-methylphenyl)methyl]-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate.
| Compound Name | diethyl (Z)-2-[(Z)-[amino-[1-[(5-fluoro-2-methylphenyl)methyl]-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate |
|---|---|
| PubChem CID | 59022475 |
| Molecular Formula | C24H34FN3O7 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | diethyl (Z)-2-[(Z)-[amino-[1-[(5-fluoro-2-methylphenyl)methyl]-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate |
| SMILES | CCOC(=O)/C=C(\O/N=C(\N)C1(OCCO)CCN(Cc2cc(F)ccc2C)CC1)C(=O)OCC |
| InChI | InChI=1S/C24H34FN3O7/c1-4-32-21(30)15-20(22(31)33-5-2)35-27-23(26)24(34-13-12-29)8-10-28(11-9-24)16-18-14-19(25)7-6-17(18)3/h6-7,14-15,29H,4-5,8-13,16H2,1-3H3,(H2,26,27)/b20-15- |
| InChIKey | RADPGDHSMCWDLI-HKWRFOASSA-N |
| XLogP | 1.78 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|