C23H31N3O8 — CID 59022462
diethyl (Z)-2-[(Z)-[amino-[1-benzoyl-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate (PubChem CID 59022462) has the molecular formula C23H31N3O8 and a molecular weight of 477.51 g/mol. Its IUPAC name is diethyl (Z)-2-[(Z)-[amino-[1-benzoyl-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate.
| Compound Name | diethyl (Z)-2-[(Z)-[amino-[1-benzoyl-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate |
|---|---|
| PubChem CID | 59022462 |
| Molecular Formula | C23H31N3O8 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | diethyl (Z)-2-[(Z)-[amino-[1-benzoyl-4-(2-hydroxyethoxy)piperidin-4-yl]methylidene]amino]oxybut-2-enedioate |
| SMILES | CCOC(=O)/C=C(\O/N=C(\N)C1(OCCO)CCN(C(=O)c2ccccc2)CC1)C(=O)OCC |
| InChI | InChI=1S/C23H31N3O8/c1-3-31-19(28)16-18(21(30)32-4-2)34-25-22(24)23(33-15-14-27)10-12-26(13-11-23)20(29)17-8-6-5-7-9-17/h5-9,16,27H,3-4,10-15H2,1-2H3,(H2,24,25)/b18-16- |
| InChIKey | OECBODYXYBSOEC-VLGSPTGOSA-N |
| XLogP | 0.97 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|