C19H26N4O6 — CID 173315489
2-[2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl]oxyacetic acid (PubChem CID 173315489) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 173315489 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl]oxyacetic acid |
| SMILES | CCCC(=O)N1CCC(OCC(=O)O)(C(N)=NO)CC1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N4O6/c1-2-6-15(24)23-10-9-19(18(20)22-28,29-12-16(25)26)11-14(23)21-17(27)13-7-4-3-5-8-13/h3-5,7-8,14,28H,2,6,9-12H2,1H3,(H2,20,22)(H,21,27)(H,25,26) |
| InChIKey | SUGNWCGCCSQPPD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 154.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|