C13H16F3Y- — CID 59024607
7,7,7-trifluoroheptan-3-ylbenzene;yttrium (PubChem CID 59024607) has the molecular formula C13H16F3Y- and a molecular weight of 318.17 g/mol. Its IUPAC name is 7,7,7-trifluoroheptan-3-ylbenzene;yttrium.
| Compound Name | 7,7,7-trifluoroheptan-3-ylbenzene;yttrium |
|---|---|
| PubChem CID | 59024607 |
| Molecular Formula | C13H16F3Y- |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 7,7,7-trifluoroheptan-3-ylbenzene;yttrium |
| SMILES | CCC(CCCC(F)(F)F)c1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C13H16F3.Y/c1-2-11(9-6-10-13(14,15)16)12-7-4-3-5-8-12;/h4-5,7-8,11H,2,6,9-10H2,1H3;/q-1; |
| InChIKey | WVROMYZCLHMTMQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|