About 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine
2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine (PubChem CID 59026288) has the molecular formula C12H17F3N2O
and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine |
| PubChem CID | 59026288 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine |
| SMILES | CC(C)(C)CCCOc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H17F3N2O/c1-11(2,3)6-4-8-18-10-16-7-5-9(17-10)12(13,14)15/h5,7H,4,6,8H2,1-3H3 |
| InChIKey | GUJPBOMYZQMMJV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine (CID 59026288) is 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine is CC(C)(C)CCCOc1nccc(C(F)(F)F)n1.
What is the InChIKey of 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine?
The InChIKey is GUJPBOMYZQMMJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2O/c1-11(2,3)6-4-8-18-10-16-7-5-9(17-10)12(13,14)15/h5,7H,4,6,8H2,1-3H3.
What are the key properties of 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine?
2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine has a molecular weight of 262.27 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylpentoxy)-4-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 59026288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).