C22H32O6 — CID 59027080
(1R,3Z,7S,9E,17R)-7-[(1R)-1,2-dihydroxyethyl]-11-hydroxy-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 59027080) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is (1R,3Z,7S,9E,17R)-7-[(1R)-1,2-dihydroxyethyl]-11-hydroxy-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (1R,3Z,7S,9E,17R)-7-[(1R)-1,2-dihydroxyethyl]-11-hydroxy-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 59027080 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (1R,3Z,7S,9E,17R)-7-[(1R)-1,2-dihydroxyethyl]-11-hydroxy-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1CCC[C@@H]2CC=C[C@@H](C/C=C\C(=O)O[C@H]([C@H](O)CO)C/C=C/C(O)C1)O2 |
| InChI | InChI=1S/C22H32O6/c1-16-6-2-8-18-9-4-10-19(27-18)11-5-13-22(26)28-21(20(25)15-23)12-3-7-17(24)14-16/h3-5,7,10,13,17-21,23-25H,1-2,6,8-9,11-12,14-15H2/b7-3+,13-5-/t17?,18-,19+,20-,21+/m1/s1 |
| InChIKey | JWZWNSGQBDFHKD-ZJHXEVONSA-N |
| XLogP | 2.35 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|