C22H21BIrN7- — CID 59027541
(3,5-dimethylpyrazol-1-yl)-di(pyrazol-1-yl)borane;iridium;2-phenylpyridine (PubChem CID 59027541) has the molecular formula C22H21BIrN7- and a molecular weight of 586.49 g/mol. Its IUPAC name is (3,5-dimethylpyrazol-1-yl)-di(pyrazol-1-yl)borane;iridium;2-phenylpyridine.
| Compound Name | (3,5-dimethylpyrazol-1-yl)-di(pyrazol-1-yl)borane;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 59027541 |
| Molecular Formula | C22H21BIrN7- |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | (3,5-dimethylpyrazol-1-yl)-di(pyrazol-1-yl)borane;iridium;2-phenylpyridine |
| SMILES | Cc1cc(C)n(B(n2cccn2)n2cccn2)n1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H13BN6.C11H8N.Ir/c1-10-9-11(2)18(15-10)12(16-7-3-5-13-16)17-8-4-6-14-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-9H,1-2H3;1-6,8-9H;/q;-1; |
| InChIKey | NXIGBDNZZIIFFZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|