C20H34N2O5Si — CID 59030224
2-(2-nitrophenyl)propyl N-[3-[dimethyl(pentan-3-yl)silyl]propoxy]carbamate (PubChem CID 59030224) has the molecular formula C20H34N2O5Si and a molecular weight of 410.59 g/mol. Its IUPAC name is 2-(2-nitrophenyl)propyl N-[3-[dimethyl(pentan-3-yl)silyl]propoxy]carbamate.
| Compound Name | 2-(2-nitrophenyl)propyl N-[3-[dimethyl(pentan-3-yl)silyl]propoxy]carbamate |
|---|---|
| PubChem CID | 59030224 |
| Molecular Formula | C20H34N2O5Si |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-(2-nitrophenyl)propyl N-[3-[dimethyl(pentan-3-yl)silyl]propoxy]carbamate |
| SMILES | CCC(CC)[Si](C)(C)CCCONC(=O)OCC(C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H34N2O5Si/c1-6-17(7-2)28(4,5)14-10-13-27-21-20(23)26-15-16(3)18-11-8-9-12-19(18)22(24)25/h8-9,11-12,16-17H,6-7,10,13-15H2,1-5H3,(H,21,23) |
| InChIKey | NQQICVYGITXSBN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|