C10H17N3 — CID 59030490
1-(1,2-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium (PubChem CID 59030490) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium.
| Compound Name | 1-(1,2-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium |
|---|---|
| PubChem CID | 59030490 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(1,2-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium |
| SMILES | [CH2-][NH+]1CCN(C2C=CC=CN2)CC1 |
| InChI | InChI=1S/C10H17N3/c1-12-6-8-13(9-7-12)10-4-2-3-5-11-10/h2-5,10-12H,1,6-9H2 |
| InChIKey | LHEJKDRYEBIAOO-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|