C28H37ClN2O3 — CID 59031261
(E)-3-[4-[2-chloro-4-(propan-2-ylamino)phenyl]-2,5-dimethoxyphenyl]-N-cyclohexyl-2-methylbut-2-enamide (PubChem CID 59031261) has the molecular formula C28H37ClN2O3 and a molecular weight of 485.07 g/mol. Its IUPAC name is (E)-3-[4-[2-chloro-4-(propan-2-ylamino)phenyl]-2,5-dimethoxyphenyl]-N-cyclohexyl-2-methylbut-2-enamide.
| Compound Name | (E)-3-[4-[2-chloro-4-(propan-2-ylamino)phenyl]-2,5-dimethoxyphenyl]-N-cyclohexyl-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 59031261 |
| Molecular Formula | C28H37ClN2O3 |
| Molecular Weight | 485.07 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (E)-3-[4-[2-chloro-4-(propan-2-ylamino)phenyl]-2,5-dimethoxyphenyl]-N-cyclohexyl-2-methylbut-2-enamide |
| SMILES | COc1cc(-c2ccc(NC(C)C)cc2Cl)c(OC)cc1/C(C)=C(\C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C28H37ClN2O3/c1-17(2)30-21-12-13-22(25(29)14-21)24-16-26(33-5)23(15-27(24)34-6)18(3)19(4)28(32)31-20-10-8-7-9-11-20/h12-17,20,30H,7-11H2,1-6H3,(H,31,32)/b19-18+ |
| InChIKey | PFIMQLAFERHXQD-VHEBQXMUSA-N |
| XLogP | 7.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.07 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|