C26H27FN2O4 — CID 59031660
(E)-N-cyclopropyl-3-[4-[2-fluoro-4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxyphenyl]-2-methylprop-2-enamide (PubChem CID 59031660) has the molecular formula C26H27FN2O4 and a molecular weight of 450.51 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-[4-[2-fluoro-4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxyphenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-[4-[2-fluoro-4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxyphenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 59031660 |
| Molecular Formula | C26H27FN2O4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (E)-N-cyclopropyl-3-[4-[2-fluoro-4-(furan-2-ylmethylamino)phenyl]-2,5-dimethoxyphenyl]-2-methylprop-2-enamide |
| SMILES | COc1cc(-c2ccc(NCc3ccco3)cc2F)c(OC)cc1/C=C(\C)C(=O)NC1CC1 |
| InChI | InChI=1S/C26H27FN2O4/c1-16(26(30)29-18-6-7-18)11-17-12-25(32-3)22(14-24(17)31-2)21-9-8-19(13-23(21)27)28-15-20-5-4-10-33-20/h4-5,8-14,18,28H,6-7,15H2,1-3H3,(H,29,30)/b16-11+ |
| InChIKey | CIQTXUOBJIHMOS-LFIBNONCSA-N |
| XLogP | 5.40 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|