C17H26O3 — CID 59033327
tert-butyl 1-[(2R)-1-cyclopropyl-3-oxobutan-2-yl]cyclopent-3-ene-1-carboxylate (PubChem CID 59033327) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is tert-butyl 1-[(2R)-1-cyclopropyl-3-oxobutan-2-yl]cyclopent-3-ene-1-carboxylate.
| Compound Name | tert-butyl 1-[(2R)-1-cyclopropyl-3-oxobutan-2-yl]cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 59033327 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | tert-butyl 1-[(2R)-1-cyclopropyl-3-oxobutan-2-yl]cyclopent-3-ene-1-carboxylate |
| SMILES | CC(=O)[C@H](CC1CC1)C1(C(=O)OC(C)(C)C)CC=CC1 |
| InChI | InChI=1S/C17H26O3/c1-12(18)14(11-13-7-8-13)17(9-5-6-10-17)15(19)20-16(2,3)4/h5-6,13-14H,7-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | PXFDEHVBWLMKET-AWEZNQCLSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|