C18H23N3O4 — CID 59033360
8-[(3S)-3-aminopiperidin-1-yl]-1-ethyl-9-methoxy-4-oxoquinolizine-3-carboxylic acid (PubChem CID 59033360) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 8-[(3S)-3-aminopiperidin-1-yl]-1-ethyl-9-methoxy-4-oxoquinolizine-3-carboxylic acid.
| Compound Name | 8-[(3S)-3-aminopiperidin-1-yl]-1-ethyl-9-methoxy-4-oxoquinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 59033360 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 8-[(3S)-3-aminopiperidin-1-yl]-1-ethyl-9-methoxy-4-oxoquinolizine-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(=O)n2ccc(N3CCC[C@H](N)C3)c(OC)c12 |
| InChI | InChI=1S/C18H23N3O4/c1-3-11-9-13(18(23)24)17(22)21-8-6-14(16(25-2)15(11)21)20-7-4-5-12(19)10-20/h6,8-9,12H,3-5,7,10,19H2,1-2H3,(H,23,24)/t12-/m0/s1 |
| InChIKey | KYDBETLXNZTXAQ-LBPRGKRZSA-N |
| XLogP | 1.50 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |