C15H19NO2 — CID 59034701
(6S,7R,7aS)-3,3,6-trimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 59034701) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (6S,7R,7aS)-3,3,6-trimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6S,7R,7aS)-3,3,6-trimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 59034701 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (6S,7R,7aS)-3,3,6-trimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C[C@@H]1C(=O)N2[C@H](COC2(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c1-10-13(11-7-5-4-6-8-11)12-9-18-15(2,3)16(12)14(10)17/h4-8,10,12-13H,9H2,1-3H3/t10-,12+,13+/m0/s1 |
| InChIKey | IDUVOTKNASBPBA-CYZMBNFOSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |