C22H27N5O3S — CID 59036020
N-(5-amino-2-methylphenyl)-2-[(3S,5R)-4-(3-isocyanophenyl)sulfonyl-3,5-dimethylpiperazin-1-yl]acetamide (PubChem CID 59036020) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-2-[(3S,5R)-4-(3-isocyanophenyl)sulfonyl-3,5-dimethylpiperazin-1-yl]acetamide.
| Compound Name | N-(5-amino-2-methylphenyl)-2-[(3S,5R)-4-(3-isocyanophenyl)sulfonyl-3,5-dimethylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 59036020 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-2-[(3S,5R)-4-(3-isocyanophenyl)sulfonyl-3,5-dimethylpiperazin-1-yl]acetamide |
| SMILES | [C-]#[N+]c1cccc(S(=O)(=O)N2[C@H](C)CN(CC(=O)Nc3cc(N)ccc3C)C[C@@H]2C)c1 |
| InChI | InChI=1S/C22H27N5O3S/c1-15-8-9-18(23)10-21(15)25-22(28)14-26-12-16(2)27(17(3)13-26)31(29,30)20-7-5-6-19(11-20)24-4/h5-11,16-17H,12-14,23H2,1-3H3,(H,25,28)/t16-,17+ |
| InChIKey | OWMFCDZNJJFXEY-CALCHBBNSA-N |
| XLogP | 2.85 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|