C15H27NO6 — CID 59036375
ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-4,5-dimethyl-6-(tritiooxymethoxymethyl)oxan-2-yl]acetate (PubChem CID 59036375) has the molecular formula C15H27NO6 and a molecular weight of 319.39 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-4,5-dimethyl-6-(tritiooxymethoxymethyl)oxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-4,5-dimethyl-6-(tritiooxymethoxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 59036375 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-4,5-dimethyl-6-(tritiooxymethoxymethyl)oxan-2-yl]acetate |
| SMILES | [3H]OCOC[C@H]1O[C@@H](CC(=O)OCC)[C@H](NC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C15H27NO6/c1-5-21-14(19)6-12-15(16-11(4)18)10(3)9(2)13(22-12)7-20-8-17/h9-10,12-13,15,17H,5-8H2,1-4H3,(H,16,18)/t9-,10-,12-,13+,15+/m0/s1/i17T |
| InChIKey | PRHOVXPUYLNKKP-HCTFOCQUSA-N |
| XLogP | 0.45 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|