C14H26N2O4 — CID 59036388
ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxan-2-yl]acetate (PubChem CID 59036388) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 59036388 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | ethyl 2-[(2S,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1O[C@H](CN)[C@@H](C)[C@H](C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H26N2O4/c1-5-19-13(18)6-11-14(16-10(4)17)9(3)8(2)12(7-15)20-11/h8-9,11-12,14H,5-7,15H2,1-4H3,(H,16,17)/t8-,9-,11-,12+,14+/m0/s1 |
| InChIKey | UMMGAUYREODYCN-GMEDAVPMSA-N |
| XLogP | 0.44 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |