C13H24N2O4 — CID 59036498
ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxane-2-carboxylate (PubChem CID 59036498) has the molecular formula C13H24N2O4 and a molecular weight of 272.35 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036498 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-(aminomethyl)-4,5-dimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](CN)[C@@H](C)[C@H](C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C13H24N2O4/c1-5-18-13(17)12-11(15-9(4)16)8(3)7(2)10(6-14)19-12/h7-8,10-12H,5-6,14H2,1-4H3,(H,15,16)/t7-,8-,10+,11+,12+/m0/s1 |
| InChIKey | PWRTWATYORNREO-VWNXEWBOSA-N |
| XLogP | 0.05 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |