C25H42FN3O7 — CID 59036455
ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate (PubChem CID 59036455) has the molecular formula C25H42FN3O7 and a molecular weight of 515.62 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59036455 |
| Molecular Formula | C25H42FN3O7 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | ethyl (2R,3R,4S,5S,6S)-3-acetamido-6-[[[(2R,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carbonyl]amino]methyl]-4,5-dimethyloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](CNC(=O)[C@@H]2O[C@H](CNC(=O)CF)[C@@H](C)[C@H](C)[C@H]2C)[C@@H](C)[C@H](C)[C@H]1NC(C)=O |
| InChI | InChI=1S/C25H42FN3O7/c1-8-34-25(33)23-21(29-17(7)30)15(5)14(4)19(36-23)11-28-24(32)22-16(6)12(2)13(3)18(35-22)10-27-20(31)9-26/h12-16,18-19,21-23H,8-11H2,1-7H3,(H,27,31)(H,28,32)(H,29,30)/t12-,13-,14-,15-,16+,18+,19+,21+,22+,23+/m0/s1 |
| InChIKey | OXYJSMQCSDDTJI-GUDVULQESA-N |
| XLogP | 0.97 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |