C13H21FN2O5 — CID 59036442
(2R,3R,4R,5S,6R)-3-acetamido-6-[2-(fluoromethoxy)-2-iminoethyl]-4,5-dimethyloxane-2-carboxylic acid (PubChem CID 59036442) has the molecular formula C13H21FN2O5 and a molecular weight of 304.32 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-acetamido-6-[2-(fluoromethoxy)-2-iminoethyl]-4,5-dimethyloxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S,6R)-3-acetamido-6-[2-(fluoromethoxy)-2-iminoethyl]-4,5-dimethyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 59036442 |
| Molecular Formula | C13H21FN2O5 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-acetamido-6-[2-(fluoromethoxy)-2-iminoethyl]-4,5-dimethyloxane-2-carboxylic acid |
| SMILES | [H]/N=C(/C[C@H]1O[C@@H](C(=O)O)[C@H](NC(C)=O)[C@H](C)[C@@H]1C)OCF |
| InChI | InChI=1S/C13H21FN2O5/c1-6-7(2)11(16-8(3)17)12(13(18)19)21-9(6)4-10(15)20-5-14/h6-7,9,11-12,15H,4-5H2,1-3H3,(H,16,17)(H,18,19)/b15-10-/t6-,7+,9+,11+,12+/m0/s1 |
| InChIKey | DMARJTMMNAPEBV-CCXWXSIOSA-N |
| XLogP | 0.93 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|