C12H20FNO4 — CID 59036463
(2S,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carboxylic acid (PubChem CID 59036463) has the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 59036463 |
| Molecular Formula | C12H20FNO4 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (2S,3R,4S,5S,6S)-6-[[(2-fluoroacetyl)amino]methyl]-3,4,5-trimethyloxane-2-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](C)[C@@H](C(=O)O)O[C@H](CNC(=O)CF)[C@H]1C |
| InChI | InChI=1S/C12H20FNO4/c1-6-7(2)9(5-14-10(15)4-13)18-11(8(6)3)12(16)17/h6-9,11H,4-5H2,1-3H3,(H,14,15)(H,16,17)/t6-,7-,8+,9+,11-/m0/s1 |
| InChIKey | GYTRWCGDNOFHSB-AQWCXSTCSA-N |
| XLogP | 0.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |