About 1λ6-thia-2-azanidacyclohexane 1,1-dioxide
1λ6-thia-2-azanidacyclohexane 1,1-dioxide (PubChem CID 59037492) has the molecular formula C4H8NO2S-
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1λ6-thia-2-azanidacyclohexane 1,1-dioxide.
Molecular Properties
| Compound Name | 1λ6-thia-2-azanidacyclohexane 1,1-dioxide |
| PubChem CID | 59037492 |
| Molecular Formula | C4H8NO2S- |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | 1λ6-thia-2-azanidacyclohexane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC[N-]1 |
| InChI | InChI=1S/C4H8NO2S/c6-8(7)4-2-1-3-5-8/h1-4H2/q-1 |
| InChIKey | DILPYXPKSKYCGS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1λ6-thia-2-azanidacyclohexane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1λ6-thia-2-azanidacyclohexane 1,1-dioxide?
The IUPAC name of 1λ6-thia-2-azanidacyclohexane 1,1-dioxide (CID 59037492) is 1λ6-thia-2-azanidacyclohexane 1,1-dioxide.
What is the SMILES notation for 1λ6-thia-2-azanidacyclohexane 1,1-dioxide?
The canonical SMILES for 1λ6-thia-2-azanidacyclohexane 1,1-dioxide is O=S1(=O)CCCC[N-]1.
What is the InChIKey of 1λ6-thia-2-azanidacyclohexane 1,1-dioxide?
The InChIKey is DILPYXPKSKYCGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO2S/c6-8(7)4-2-1-3-5-8/h1-4H2/q-1.
What are the key properties of 1λ6-thia-2-azanidacyclohexane 1,1-dioxide?
1λ6-thia-2-azanidacyclohexane 1,1-dioxide has a molecular weight of 134.18 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1λ6-thia-2-azanidacyclohexane 1,1-dioxide is sourced from PubChem (CID 59037492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).