C15H26N2O5 — CID 59038128
ethyl (E,4S)-7-(methylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxohept-2-enoate (PubChem CID 59038128) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl (E,4S)-7-(methylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-(methylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 59038128 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | ethyl (E,4S)-7-(methylamino)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)NC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N2O5/c1-6-21-13(19)10-8-11(7-9-12(18)16-5)17-14(20)22-15(2,3)4/h8,10-11H,6-7,9H2,1-5H3,(H,16,18)(H,17,20)/b10-8+/t11-/m0/s1 |
| InChIKey | XXUFNZUVAKHZCD-UQSGXBNBSA-N |
| XLogP | 1.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|