C10H22O2 — CID 59039431
(3R)-3-ethyl-3-methoxy-2,4-dimethylpentan-2-ol (PubChem CID 59039431) has the molecular formula C10H22O2 and a molecular weight of 174.28 g/mol. Its IUPAC name is (3R)-3-ethyl-3-methoxy-2,4-dimethylpentan-2-ol.
| Compound Name | (3R)-3-ethyl-3-methoxy-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 59039431 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | (3R)-3-ethyl-3-methoxy-2,4-dimethylpentan-2-ol |
| SMILES | CC[C@@](OC)(C(C)C)C(C)(C)O |
| InChI | InChI=1S/C10H22O2/c1-7-10(12-6,8(2)3)9(4,5)11/h8,11H,7H2,1-6H3/t10-/m1/s1 |
| InChIKey | XWCGUNCRDIOUFW-SNVBAGLBSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |