C11H24O2 — CID 59039602
(2R)-2-methoxy-3,3-dimethyl-2-propan-2-ylpentan-1-ol (PubChem CID 59039602) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is (2R)-2-methoxy-3,3-dimethyl-2-propan-2-ylpentan-1-ol.
| Compound Name | (2R)-2-methoxy-3,3-dimethyl-2-propan-2-ylpentan-1-ol |
|---|---|
| PubChem CID | 59039602 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (2R)-2-methoxy-3,3-dimethyl-2-propan-2-ylpentan-1-ol |
| SMILES | CCC(C)(C)[C@](CO)(OC)C(C)C |
| InChI | InChI=1S/C11H24O2/c1-7-10(4,5)11(8-12,13-6)9(2)3/h9,12H,7-8H2,1-6H3/t11-/m1/s1 |
| InChIKey | UMMNTKARLXQZPN-LLVKDONJSA-N |
| XLogP | 2.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |