C14H26O6 — CID 139815521
[3-hydroxy-1-methoxy-2,2-dimethyl-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate (PubChem CID 139815521) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is [3-hydroxy-1-methoxy-2,2-dimethyl-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate.
| Compound Name | [3-hydroxy-1-methoxy-2,2-dimethyl-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 139815521 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [3-hydroxy-1-methoxy-2,2-dimethyl-1-(2-methylpropanoyloxy)propyl] 2-methylpropanoate |
| SMILES | COC(OC(=O)C(C)C)(OC(=O)C(C)C)C(C)(C)CO |
| InChI | InChI=1S/C14H26O6/c1-9(2)11(16)19-14(18-7,13(5,6)8-15)20-12(17)10(3)4/h9-10,15H,8H2,1-7H3 |
| InChIKey | PEKPZWOHWMZAOV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|