C19H29NO4 — CID 59039734
ethenyl (1R,5S)-9-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)-1,5-dimethyl-3-azabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 59039734) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is ethenyl (1R,5S)-9-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)-1,5-dimethyl-3-azabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | ethenyl (1R,5S)-9-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)-1,5-dimethyl-3-azabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 59039734 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | ethenyl (1R,5S)-9-(3-ethoxy-2-methyl-3-oxoprop-1-enyl)-1,5-dimethyl-3-azabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | C=COC(=O)N1C[C@]2(C)CCC[C@](C)(C1)C2C=C(C)C(=O)OCC |
| InChI | InChI=1S/C19H29NO4/c1-6-23-16(21)14(3)11-15-18(4)9-8-10-19(15,5)13-20(12-18)17(22)24-7-2/h7,11,15H,2,6,8-10,12-13H2,1,3-5H3/t15?,18-,19+ |
| InChIKey | CVPOKMBPKPMFTO-QNBRMCRTSA-N |
| XLogP | 3.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|