C18H27NO4 — CID 59039750
ethenyl 9-[(Z)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-3-azabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 59039750) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is ethenyl 9-[(Z)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-3-azabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | ethenyl 9-[(Z)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-3-azabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 59039750 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | ethenyl 9-[(Z)-4-ethoxy-3-methyl-4-oxobut-2-enyl]-3-azabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | C=COC(=O)N1CC2CCCC(C1)C2C/C=C(/C)C(=O)OCC |
| InChI | InChI=1S/C18H27NO4/c1-4-22-17(20)13(3)9-10-16-14-7-6-8-15(16)12-19(11-14)18(21)23-5-2/h5,9,14-16H,2,4,6-8,10-12H2,1,3H3/b13-9- |
| InChIKey | PQXHJDHGELMVPM-LCYFTJDESA-N |
| XLogP | 3.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|