C8H10F3NO2 — CID 59041040
1-[(2S)-2-acetylpyrrolidin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 59041040) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is 1-[(2S)-2-acetylpyrrolidin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2S)-2-acetylpyrrolidin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 59041040 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-[(2S)-2-acetylpyrrolidin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC(=O)[C@@H]1CCCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO2/c1-5(13)6-3-2-4-12(6)7(14)8(9,10)11/h6H,2-4H2,1H3/t6-/m0/s1 |
| InChIKey | YYYRDXGMUCTAST-LURJTMIESA-N |
| XLogP | 1.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |