About 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone
1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone (PubChem CID 59215643) has the molecular formula C7H11F2NO
and a molecular weight of 163.17 g/mol. Its IUPAC name is 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone.
Analyze 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone?
The IUPAC name of 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone (CID 59215643) is 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone.
What is the SMILES notation for 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone?
The canonical SMILES for 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone is CC(=O)[C@@H]1CC(F)(F)CN1C.
What is the InChIKey of 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone?
The InChIKey is KUSCKKZFMPJEDS-LURJTMIESA-N. The full InChI is InChI=1S/C7H11F2NO/c1-5(11)6-3-7(8,9)4-10(6)2/h6H,3-4H2,1-2H3/t6-/m0/s1.
What are the key properties of 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone?
1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone has a molecular weight of 163.17 g/mol, XLogP of 0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]ethanone is sourced from PubChem (CID 59215643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).