About CID 59041172
CID 59041172 (PubChem CID 59041172) has the molecular formula C15H27N2O
and a molecular weight of 251.39 g/mol.
Molecular Properties
| Compound Name | CID 59041172 |
| PubChem CID | 59041172 |
| Molecular Formula | C15H27N2O |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | — |
| SMILES | CC(C)(C)CC(C)(C)N([O])C1(C#N)CCCCC1 |
| InChI | InChI=1S/C15H27N2O/c1-13(2,3)11-14(4,5)17(18)15(12-16)9-7-6-8-10-15/h6-11H2,1-5H3 |
| InChIKey | HQMCIGBVHGYSLK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59041172 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59041172?
The IUPAC name of CID 59041172 (CID 59041172) is not available.
What is the SMILES notation for CID 59041172?
The canonical SMILES for CID 59041172 is CC(C)(C)CC(C)(C)N([O])C1(C#N)CCCCC1.
What is the InChIKey of CID 59041172?
The InChIKey is HQMCIGBVHGYSLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N2O/c1-13(2,3)11-14(4,5)17(18)15(12-16)9-7-6-8-10-15/h6-11H2,1-5H3.
What are the key properties of CID 59041172?
CID 59041172 has a molecular weight of 251.39 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59041172 is sourced from PubChem (CID 59041172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).