C22H33N3O2 — CID 75445714
2-[benzyl-(1-methoxy-2-methylpropan-2-yl)amino]-N-(1-cyanocyclohexyl)-N-methylacetamide (PubChem CID 75445714) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-[benzyl-(1-methoxy-2-methylpropan-2-yl)amino]-N-(1-cyanocyclohexyl)-N-methylacetamide.
| Compound Name | 2-[benzyl-(1-methoxy-2-methylpropan-2-yl)amino]-N-(1-cyanocyclohexyl)-N-methylacetamide |
|---|---|
| PubChem CID | 75445714 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2-[benzyl-(1-methoxy-2-methylpropan-2-yl)amino]-N-(1-cyanocyclohexyl)-N-methylacetamide |
| SMILES | COCC(C)(C)N(CC(=O)N(C)C1(C#N)CCCCC1)Cc1ccccc1 |
| InChI | InChI=1S/C22H33N3O2/c1-21(2,18-27-4)25(15-19-11-7-5-8-12-19)16-20(26)24(3)22(17-23)13-9-6-10-14-22/h5,7-8,11-12H,6,9-10,13-16,18H2,1-4H3 |
| InChIKey | KXTYQFOANFOPGF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |