C24H30N3O+ — CID 9494211
benzhydryl-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylazanium (PubChem CID 9494211) has the molecular formula C24H30N3O+ and a molecular weight of 376.52 g/mol. Its IUPAC name is benzhydryl-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylazanium.
| Compound Name | benzhydryl-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9494211 |
| Molecular Formula | C24H30N3O+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | benzhydryl-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-methylazanium |
| SMILES | CN(C(=O)C[NH+](C)C(c1ccccc1)c1ccccc1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C24H29N3O/c1-26(18-22(28)27(2)24(19-25)16-10-5-11-17-24)23(20-12-6-3-7-13-20)21-14-8-4-9-15-21/h3-4,6-9,12-15,23H,5,10-11,16-18H2,1-2H3/p+1 |
| InChIKey | NSHPJBDOMNOZNR-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |