C18H26N3O+ — CID 9248524
[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium (PubChem CID 9248524) has the molecular formula C18H26N3O+ and a molecular weight of 300.43 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium.
| Compound Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9248524 |
| Molecular Formula | C18H26N3O+ |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)N(C)C1(C#N)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O/c1-15(16-9-5-3-6-10-16)20-13-17(22)21(2)18(14-19)11-7-4-8-12-18/h3,5-6,9-10,15,20H,4,7-8,11-13H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | RTBLNGYVOFONRE-HNNXBMFYSA-O |
| XLogP | 2.00 |
| TPSA | 60.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |