C18H22N2O4 — CID 7697673
[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 2-phenoxyacetate (PubChem CID 7697673) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 2-phenoxyacetate.
| Compound Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 7697673 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethyl] 2-phenoxyacetate |
| SMILES | CN(C(=O)COC(=O)COc1ccccc1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C18H22N2O4/c1-20(18(14-19)10-6-3-7-11-18)16(21)12-24-17(22)13-23-15-8-4-2-5-9-15/h2,4-5,8-9H,3,6-7,10-13H2,1H3 |
| InChIKey | AAHMXQICJDPCBZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |