C24H27N3O3 — CID 9381716
N-benzyl-2-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethoxy]benzamide (PubChem CID 9381716) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-benzyl-2-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethoxy]benzamide.
| Compound Name | N-benzyl-2-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 9381716 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-benzyl-2-[2-[(1-cyanocyclohexyl)-methylamino]-2-oxoethoxy]benzamide |
| SMILES | CN(C(=O)COc1ccccc1C(=O)NCc1ccccc1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C24H27N3O3/c1-27(24(18-25)14-8-3-9-15-24)22(28)17-30-21-13-7-6-12-20(21)23(29)26-16-19-10-4-2-5-11-19/h2,4-7,10-13H,3,8-9,14-17H2,1H3,(H,26,29) |
| InChIKey | IIEBZXHUMQFHQG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |